Products 2680821-04-7
CAS 2680821-04-7 is the registry number for tert-Butyl (6-chloro-2-methyl-3-oxo-2,3-dihydropyridazin-4-yl)carbamate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl N-(6-chloro-2-methyl-3-oxopyridazin-4-yl)carbamate (CAS 2680821-04-7) is a chemical compound with the molecular formula C10H14ClN3O3 and a molecular weight of 259.69 g/mol. IUPAC name: tert-butyl N-(6-chloro-2-methyl-3-oxopyridazin-4-yl)carbamate. InChIKey: KSACDPIGRZWEFZ-UHFFFAOYSA-N.
| Molecular formula | C10H14ClN3O3 |
|---|---|
| Molecular weight | 259.69 g/mol |
| IUPAC name | tert-butyl N-(6-chloro-2-methyl-3-oxopyridazin-4-yl)carbamate |
| InChIKey | KSACDPIGRZWEFZ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1=CC(=NN(C1=O)C)Cl |
Computed by PubChem (NCBI)