CAS 568574-78-7 is the registry number for 2-Chloro-N-{2,4-dioxo-1,3-diazaspiro(4.5)decan-3-yl}acetamide, 95%. Offered by: AmBeed. Available pack sizes: 1mg.
2-chloro-N-(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetamide (CAS 568574-78-7) is a chemical compound with the molecular formula C10H14ClN3O3 and a molecular weight of 259.69 g/mol. IUPAC name: 2-chloro-N-(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetamide. InChIKey: LBKWFLLIJCWXGB-UHFFFAOYSA-N.
| Molecular formula | C10H14ClN3O3 |
|---|---|
| Molecular weight | 259.69 g/mol |
| IUPAC name | 2-chloro-N-(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetamide |
| InChIKey | LBKWFLLIJCWXGB-UHFFFAOYSA-N |
| SMILES | C1CCC2(CC1)C(=O)N(C(=O)N2)NC(=O)CCl |
Computed by PubChem (NCBI)