Products 2681278-26-0

CAS 2681278-26-0 is the registry number for Ethyl 7-bromo-4-oxo-4,5-dihydro-1H-pyrido[3,2-b]indole-3-carboxylate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

Ethyl 7-bromo-4-oxo-1,5-dihydropyrido[3,2-b]indole-3-carboxylate (CAS 2681278-26-0) is a chemical compound with the molecular formula C14H11BrN2O3 and a molecular weight of 335.15 g/mol. IUPAC name: ethyl 7-bromo-4-oxo-1,5-dihydropyrido[3,2-b]indole-3-carboxylate. InChIKey: JQYGYKUCGRMATJ-UHFFFAOYSA-N.

Identity
Molecular formulaC14H11BrN2O3
Molecular weight335.15 g/mol
IUPAC nameethyl 7-bromo-4-oxo-1,5-dihydropyrido[3,2-b]indole-3-carboxylate
InChIKeyJQYGYKUCGRMATJ-UHFFFAOYSA-N
SMILESCCOC(=O)C1=CNC2=C(C1=O)NC3=C2C=CC(=C3)Br

Computed by PubChem (NCBI)