CAS 2681278-26-0 is the registry number for Ethyl 7-bromo-4-oxo-4,5-dihydro-1H-pyrido[3,2-b]indole-3-carboxylate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Ethyl 7-bromo-4-oxo-1,5-dihydropyrido[3,2-b]indole-3-carboxylate (CAS 2681278-26-0) is a chemical compound with the molecular formula C14H11BrN2O3 and a molecular weight of 335.15 g/mol. IUPAC name: ethyl 7-bromo-4-oxo-1,5-dihydropyrido[3,2-b]indole-3-carboxylate. InChIKey: JQYGYKUCGRMATJ-UHFFFAOYSA-N.
| Molecular formula | C14H11BrN2O3 |
|---|---|
| Molecular weight | 335.15 g/mol |
| IUPAC name | ethyl 7-bromo-4-oxo-1,5-dihydropyrido[3,2-b]indole-3-carboxylate |
| InChIKey | JQYGYKUCGRMATJ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CNC2=C(C1=O)NC3=C2C=CC(=C3)Br |
Computed by PubChem (NCBI)