Products 2983847-02-3
CAS 2983847-02-3 is the registry number for 1-(5-bromo-1-oxo-isoindolin-2-yl)-3-azabicyclo[3.1.1]heptane-2,4-dione, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg.
1-(6-bromo-3-oxo-1H-isoindol-2-yl)-3-azabicyclo[3.1.1]heptane-2,4-dione (CAS 2983847-02-3) is a chemical compound with the molecular formula C14H11BrN2O3 and a molecular weight of 335.15 g/mol. IUPAC name: 1-(6-bromo-3-oxo-1H-isoindol-2-yl)-3-azabicyclo[3.1.1]heptane-2,4-dione. InChIKey: LPVOIFAMVXRKJI-UHFFFAOYSA-N.
| Molecular formula | C14H11BrN2O3 |
|---|---|
| Molecular weight | 335.15 g/mol |
| IUPAC name | 1-(6-bromo-3-oxo-1H-isoindol-2-yl)-3-azabicyclo[3.1.1]heptane-2,4-dione |
| InChIKey | LPVOIFAMVXRKJI-UHFFFAOYSA-N |
| SMILES | C1C2CC1(C(=O)NC2=O)N3CC4=C(C3=O)C=CC(=C4)Br |
Computed by PubChem (NCBI)