CAS 2681395-32-2 is the registry number for 3-Bromo-5,7-dichloro-6-fluoropyrazolo[1,5-a]pyrimidine, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
3-bromo-5,7-dichloro-6-fluoropyrazolo[1,5-a]pyrimidine (CAS 2681395-32-2) is a chemical compound with the molecular formula C6HBrCl2FN3 and a molecular weight of 284.90 g/mol. IUPAC name: 3-bromo-5,7-dichloro-6-fluoropyrazolo[1,5-a]pyrimidine. InChIKey: CMNXDNVOWKTPHM-UHFFFAOYSA-N.
| Molecular formula | C6HBrCl2FN3 |
|---|---|
| Molecular weight | 284.90 g/mol |
| IUPAC name | 3-bromo-5,7-dichloro-6-fluoropyrazolo[1,5-a]pyrimidine |
| InChIKey | CMNXDNVOWKTPHM-UHFFFAOYSA-N |
| SMILES | C1=NN2C(=C1Br)N=C(C(=C2Cl)F)Cl |
Computed by PubChem (NCBI)