Products 2841474-77-7
CAS 2841474-77-7 appears in our catalog under these names: 7-bromo-2,4-dichloro-5-fluoro-pyrrolo[2,1-f][1,2,4]triazine, 97%, 97%, 7-bromo-2,4-dichloro-5-fluoro-pyrrolo[2,1-f][1,2,4]triazine, 97%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 500mg, 1g.
7-bromo-2,4-dichloro-5-fluoropyrrolo[2,1-f][1,2,4]triazine (CAS 2841474-77-7) is a chemical compound with the molecular formula C6HBrCl2FN3 and a molecular weight of 284.90 g/mol. IUPAC name: 7-bromo-2,4-dichloro-5-fluoropyrrolo[2,1-f][1,2,4]triazine. InChIKey: RMFXMLVITVNBHQ-UHFFFAOYSA-N.
| Molecular formula | C6HBrCl2FN3 |
|---|---|
| Molecular weight | 284.90 g/mol |
| IUPAC name | 7-bromo-2,4-dichloro-5-fluoropyrrolo[2,1-f][1,2,4]triazine |
| InChIKey | RMFXMLVITVNBHQ-UHFFFAOYSA-N |
| SMILES | C1=C(N2C(=C1F)C(=NC(=N2)Cl)Cl)Br |
Computed by PubChem (NCBI)