CAS 2681395-75-3 is the registry number for 2-Fluoro-3-methoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-fluoro-3-methoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline (CAS 2681395-75-3) is a chemical compound with the molecular formula C13H19BFNO3 and a molecular weight of 267.11 g/mol. IUPAC name: 2-fluoro-3-methoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline. InChIKey: WVZNXYNQLNKRNP-UHFFFAOYSA-N.
| Molecular formula | C13H19BFNO3 |
|---|---|
| Molecular weight | 267.11 g/mol |
| IUPAC name | 2-fluoro-3-methoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline |
| InChIKey | WVZNXYNQLNKRNP-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=C(C(=C2)OC)F)N |
Computed by PubChem (NCBI)