Products 3023284-78-5
CAS 3023284-78-5 is the registry number for 3-Fluoro-2-methoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline, 98%. Offered by: Fluorochem. Available pack sizes: 50mg, 100mg, 250mg, 1g.
3-fluoro-2-methoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline (CAS 3023284-78-5) is a chemical compound with the molecular formula C13H19BFNO3 and a molecular weight of 267.11 g/mol. IUPAC name: 3-fluoro-2-methoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline. InChIKey: JERQYJAQFFDSLC-UHFFFAOYSA-N.
| Molecular formula | C13H19BFNO3 |
|---|---|
| Molecular weight | 267.11 g/mol |
| IUPAC name | 3-fluoro-2-methoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline |
| InChIKey | JERQYJAQFFDSLC-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=C(C(=C2)F)OC)N |
Computed by PubChem (NCBI)