Products 2682097-64-7
CAS 2682097-64-7 appears in our catalog under these names: (2S,3R)-3-(Allyloxy)-2-aminobutanoic acid hydrochloride, 96%, 96%, O-Allyl-L-threonine hydrochloride, 96%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
(2S,3R)-2-amino-3-prop-2-enoxybutanoic acid;hydrochloride (CAS 2682097-64-7) is a chemical compound with the molecular formula C7H14ClNO3 and a molecular weight of 195.64 g/mol. IUPAC name: (2S,3R)-2-amino-3-prop-2-enoxybutanoic acid;hydrochloride. InChIKey: UQCCVMOLNMDLHP-IBTYICNHSA-N.
| Molecular formula | C7H14ClNO3 |
|---|---|
| Molecular weight | 195.64 g/mol |
| IUPAC name | (2S,3R)-2-amino-3-prop-2-enoxybutanoic acid;hydrochloride |
| InChIKey | UQCCVMOLNMDLHP-IBTYICNHSA-N |
| SMILES | C[C@H]([C@@H](C(=O)O)N)OCC=C.Cl |
Computed by PubChem (NCBI)
Synonyms:
(2S,3R)-3-(Allyloxy)-2-aminobutanoic acid hydrochloride, O-allyl-L-threonine hydrochloride, starbld0029213, (2S,3R)-3-(Allyloxy)-2-aminobutanoic Acid HCl, (2S,3R)-3-allyloxy-2-amino-butanoic acid;hydrochloride, (2S,3R)-2-amino-3-prop-2-enoxybutanoic acid;hydrochloride, H-O-2-Propen-1-yl-Thr-OH inverted exclamation mark currencyHCl