Products 2682112-51-0
CAS 2682112-51-0 appears in our catalog under these names: (4-(Hydrazinylmethyl)phenyl)(pyrrolidin-1-yl)methanone hydrochloride, 97%, 97%, (4-(Hydrazinylmethyl)phenyl)(pyrrolidin-1-yl)methanone hydrochloride, 97%. Offered by: Chemat, Ambeed, BLDpharm. Available pack sizes: 100mg, 250mg, 1g, 5g.
[4-(hydrazinylmethyl)phenyl]-pyrrolidin-1-ylmethanone;hydrochloride (CAS 2682112-51-0) is a chemical compound with the molecular formula C12H18ClN3O and a molecular weight of 255.74 g/mol. IUPAC name: [4-(hydrazinylmethyl)phenyl]-pyrrolidin-1-ylmethanone;hydrochloride. InChIKey: XYLWQUPFGWKESK-UHFFFAOYSA-N.
| Molecular formula | C12H18ClN3O |
|---|---|
| Molecular weight | 255.74 g/mol |
| IUPAC name | [4-(hydrazinylmethyl)phenyl]-pyrrolidin-1-ylmethanone;hydrochloride |
| InChIKey | XYLWQUPFGWKESK-UHFFFAOYSA-N |
| SMILES | C1CCN(C1)C(=O)C2=CC=C(C=C2)CNN.Cl |
Computed by PubChem (NCBI)