CAS 268221-76-7 appears in our catalog under these names: Cyclo (L-Ala-L-Gln), Cyclo(-Ala-Gln), Cyclo(-Ala-Gln), >95% (HPLC), Cyclo(–Ala–Gln), Cyclo(-Ala-Gln), 98%, 98%. Offered by: Chemat Brand, TRC, GLPBio, Biosynth, Chemat. Available pack sizes: on request, 25mg, 50mg, 5mg, 1g, 250mg, 100mg, 10mg.
3-[(2S,5S)-5-methyl-3,6-dioxopiperazin-2-yl]propanamide (CAS 268221-76-7) is a chemical compound with the molecular formula C8H13N3O3 and a molecular weight of 199.21 g/mol. IUPAC name: 3-[(2S,5S)-5-methyl-3,6-dioxopiperazin-2-yl]propanamide. InChIKey: PNSKRAHOHQWAAN-WHFBIAKZSA-N.
| Molecular formula | C8H13N3O3 |
|---|---|
| Molecular weight | 199.21 g/mol |
| IUPAC name | 3-[(2S,5S)-5-methyl-3,6-dioxopiperazin-2-yl]propanamide |
| InChIKey | PNSKRAHOHQWAAN-WHFBIAKZSA-N |
| SMILES | C[C@H]1C(=O)N[C@H](C(=O)N1)CCC(=O)N |
Computed by PubChem (NCBI)