CAS 2703745-19-9 is the registry number for Glutamine Impurity 7. Offered by: Chemat Brand. Available pack sizes: on request.
(2S)-2-amino-N-[(3S)-2,6-dioxopiperidin-3-yl]propanamide (CAS 2703745-19-9) is a chemical compound with the molecular formula C8H13N3O3 and a molecular weight of 199.21 g/mol. IUPAC name: (2S)-2-amino-N-[(3S)-2,6-dioxopiperidin-3-yl]propanamide. InChIKey: YXVYMYJUVFYWDY-WHFBIAKZSA-N.
| Molecular formula | C8H13N3O3 |
|---|---|
| Molecular weight | 199.21 g/mol |
| IUPAC name | (2S)-2-amino-N-[(3S)-2,6-dioxopiperidin-3-yl]propanamide |
| InChIKey | YXVYMYJUVFYWDY-WHFBIAKZSA-N |
| SMILES | C[C@@H](C(=O)N[C@H]1CCC(=O)NC1=O)N |
Computed by PubChem (NCBI)