Products 2684294-31-1
CAS 2684294-31-1 is the registry number for TERT-BUTYL (R)-(1-(4-(BENZYLTHIO)PHENYL)ETHYL)CARBAMATE, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g.
Tert-butyl N-[(1R)-1-(4-benzylsulfanylphenyl)ethyl]carbamate (CAS 2684294-31-1) is a chemical compound with the molecular formula C20H25NO2S and a molecular weight of 343.5 g/mol. IUPAC name: tert-butyl N-[(1R)-1-(4-benzylsulfanylphenyl)ethyl]carbamate. InChIKey: BETIGOZUTCFRPL-OAHLLOKOSA-N.
| Molecular formula | C20H25NO2S |
|---|---|
| Molecular weight | 343.5 g/mol |
| IUPAC name | tert-butyl N-[(1R)-1-(4-benzylsulfanylphenyl)ethyl]carbamate |
| InChIKey | BETIGOZUTCFRPL-OAHLLOKOSA-N |
| SMILES | C[C@H](C1=CC=C(C=C1)SCC2=CC=CC=C2)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)