Products 562079-21-4
CAS 562079-21-4 is the registry number for 1-((4-(tert-butyl)phenyl)sulfonyl)-6-methyl-1,2,3,4-tetrahydroquinoline. Offered by: Biosynth. Available pack sizes: 250mg.
1-(4-tert-butylphenyl)sulfonyl-6-methyl-3,4-dihydro-2H-quinoline (CAS 562079-21-4) is a chemical compound with the molecular formula C20H25NO2S and a molecular weight of 343.5 g/mol. IUPAC name: 1-(4-tert-butylphenyl)sulfonyl-6-methyl-3,4-dihydro-2H-quinoline. InChIKey: HPACZNSFSPHFAV-UHFFFAOYSA-N.
| Molecular formula | C20H25NO2S |
|---|---|
| Molecular weight | 343.5 g/mol |
| IUPAC name | 1-(4-tert-butylphenyl)sulfonyl-6-methyl-3,4-dihydro-2H-quinoline |
| InChIKey | HPACZNSFSPHFAV-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1)N(CCC2)S(=O)(=O)C3=CC=C(C=C3)C(C)(C)C |
Computed by PubChem (NCBI)