CAS 268543-19-7 appears in our catalog under these names: 1-(Adamantan-1-yl)-2-phenylethan-1-one, 95%, 1-(Adamantan-1-yl)-2-phenylethan-1-one. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 0,5g, 50mg.
1-(1-adamantyl)-2-phenylethanone (CAS 268543-19-7) is a chemical compound with the molecular formula C18H22O and a molecular weight of 254.4 g/mol. IUPAC name: 1-(1-adamantyl)-2-phenylethanone. InChIKey: SKTHMJQGDPAHEX-UHFFFAOYSA-N.
| Molecular formula | C18H22O |
|---|---|
| Molecular weight | 254.4 g/mol |
| IUPAC name | 1-(1-adamantyl)-2-phenylethanone |
| InChIKey | SKTHMJQGDPAHEX-UHFFFAOYSA-N |
| SMILES | C1C2CC3CC1CC(C2)(C3)C(=O)CC4=CC=CC=C4 |
Computed by PubChem (NCBI)