CAS 27648-26-6 is the registry number for 2-(Adamantan-1-yl)-1-phenylethan-1-one. Offered by: Biosynth. Available pack sizes: 0,5g, 5g.
2-(1-adamantyl)-1-phenylethanone (CAS 27648-26-6) is a chemical compound with the molecular formula C18H22O and a molecular weight of 254.4 g/mol. IUPAC name: 2-(1-adamantyl)-1-phenylethanone. InChIKey: YRBSXKFXIFONEN-UHFFFAOYSA-N.
| Molecular formula | C18H22O |
|---|---|
| Molecular weight | 254.4 g/mol |
| IUPAC name | 2-(1-adamantyl)-1-phenylethanone |
| InChIKey | YRBSXKFXIFONEN-UHFFFAOYSA-N |
| SMILES | C1C2CC3CC1CC(C2)(C3)CC(=O)C4=CC=CC=C4 |
Computed by PubChem (NCBI)