CAS 2688-84-8 appears in our catalog under these names: Nimesulide EP Impurity C (2-phenoxyaniline), Nimesulide EP Impurity C, 2-Phenoxylaniline, >95% (HPLC), 2-Phenoxyaniline, 2–Phenoxyaniline. Offered by: Chemat Brand, TRC, Mikromol, GLPBio, Chemat. Available pack sizes: on request, 100g, 25g, 5g, 25mg, 100mg, 500g, 0,25kg.
2-phenoxyaniline (CAS 2688-84-8) is a chemical compound with the molecular formula C12H11NO and a molecular weight of 185.22 g/mol. IUPAC name: 2-phenoxyaniline. InChIKey: NMFFUUFPJJOWHK-UHFFFAOYSA-N.
| Molecular formula | C12H11NO |
|---|---|
| Molecular weight | 185.22 g/mol |
| IUPAC name | 2-phenoxyaniline |
| InChIKey | NMFFUUFPJJOWHK-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)OC2=CC=CC=C2N |
Computed by PubChem (NCBI)