CAS 281655-32-1 appears in our catalog under these names: Fmoc-(2S,3R)-3-phenylpyrrolidine-2-carboxylic acid, Fmoc-(2S,3R)-3-phenylpyrrolidine-2-carboxylic acid, 97%, Fmoc-(2S,3R)-3-phenylpyrrolidine-2-carboxylic acid, 97%, 97%. Offered by: Creative Peptides, AmBeed, Chemat. Available pack sizes: on request, 1g, 100mg, 250mg, 500mg, 5g.
(2S,3R)-1-(9H-fluoren-9-ylmethoxycarbonyl)-3-phenylpyrrolidine-2-carboxylic acid (CAS 281655-32-1) is a chemical compound with the molecular formula C26H23NO4 and a molecular weight of 413.5 g/mol. IUPAC name: (2S,3R)-1-(9H-fluoren-9-ylmethoxycarbonyl)-3-phenylpyrrolidine-2-carboxylic acid. InChIKey: XZINBBVSLWSWBO-KOSHJBKYSA-N.
| Molecular formula | C26H23NO4 |
|---|---|
| Molecular weight | 413.5 g/mol |
| IUPAC name | (2S,3R)-1-(9H-fluoren-9-ylmethoxycarbonyl)-3-phenylpyrrolidine-2-carboxylic acid |
| InChIKey | XZINBBVSLWSWBO-KOSHJBKYSA-N |
| SMILES | C1CN([C@@H]([C@H]1C2=CC=CC=C2)C(=O)O)C(=O)OCC3C4=CC=CC=C4C5=CC=CC=C35 |
Computed by PubChem (NCBI)