Products 2692622-57-2

CAS 2692622-57-2 appears in our catalog under these names: Docosahexaenoic Acid Alkyne, Docosahexaenoic acid alkyne. Offered by: GLPBio, MedChemExpress. Available pack sizes: 100μg, 500μg, 100 μg.

Structural formula: {0} (CAS {1})

(4Z,7Z,10Z,13Z,16Z,19Z)-docosa-4,7,10,13,16,19-hexaen-21-ynoic acid (CAS 2692622-57-2) is a chemical compound with the molecular formula C22H28O2 and a molecular weight of 324.5 g/mol. IUPAC name: (4Z,7Z,10Z,13Z,16Z,19Z)-docosa-4,7,10,13,16,19-hexaen-21-ynoic acid. InChIKey: XTZUIIMXQHORMY-KUBAVDMBSA-N.

Identity
Molecular formulaC22H28O2
Molecular weight324.5 g/mol
IUPAC name(4Z,7Z,10Z,13Z,16Z,19Z)-docosa-4,7,10,13,16,19-hexaen-21-ynoic acid
InChIKeyXTZUIIMXQHORMY-KUBAVDMBSA-N
SMILESC#C/C=C\C/C=C\C/C=C\C/C=C\C/C=C\C/C=C\CCC(=O)O

Computed by PubChem (NCBI)