Products 2692624-12-5
CAS 2692624-12-5 appears in our catalog under these names: 5(Z),8(Z),11(Z)–Eicosatrienoic Acid–d6, Mead acid–d6, Mead acid-d6. Offered by: GLPBio, MedChemExpress. Available pack sizes: 1mg, 100μg, 500μg, 100 μg.
(5E,8E,11E)-5,6,8,9,11,12-hexadeuterioicosa-5,8,11-trienoic acid (CAS 2692624-12-5) is a chemical compound with the molecular formula C20H34O2 and a molecular weight of 312.5 g/mol. IUPAC name: (5E,8E,11E)-5,6,8,9,11,12-hexadeuterioicosa-5,8,11-trienoic acid. InChIKey: UNSRRHDPHVZAHH-GHYBKGMKSA-N.
| Molecular formula | C20H34O2 |
|---|---|
| Molecular weight | 312.5 g/mol |
| IUPAC name | (5E,8E,11E)-5,6,8,9,11,12-hexadeuterioicosa-5,8,11-trienoic acid |
| InChIKey | UNSRRHDPHVZAHH-GHYBKGMKSA-N |
| SMILES | [2H]/C(=C(/[2H])\C/C(=C(\[2H])/C/C(=C(\[2H])/CCCC(=O)O)/[2H])/[2H])/CCCCCCCC |
Computed by PubChem (NCBI)
Synonyms:
5(Z),8(Z),11(Z)-Eicosatrienoic Acid-d6