CAS 2692624-43-2 is the registry number for Hexanoyl-L-carnitine-d3 (hydrochloride). Offered by: MedChemExpress. Available pack sizes: 10 mg, 25 mg.
[(2S)-3-carboxy-2-hexanoyloxypropyl]-trimethylazanium (CAS 2692624-43-2) is a chemical compound with the molecular formula C13H26NO4+ and a molecular weight of 260.35 g/mol. IUPAC name: [(2S)-3-carboxy-2-hexanoyloxypropyl]-trimethylazanium. InChIKey: VVPRQWTYSNDTEA-NSHDSACASA-O.
| Molecular formula | C13H26NO4+ |
|---|---|
| Molecular weight | 260.35 g/mol |
| IUPAC name | [(2S)-3-carboxy-2-hexanoyloxypropyl]-trimethylazanium |
| InChIKey | VVPRQWTYSNDTEA-NSHDSACASA-O |
| SMILES | CCCCCC(=O)O[C@@H](CC(=O)O)C[N+](C)(C)C |
Computed by PubChem (NCBI)