CAS 6418-78-6 appears in our catalog under these names: Hexanoylcarnitine, CP≥96%, ≥98 atom% D, CP≥96%, ≥98 atom% D, (±)-Hexanoylcarnitine, 99.83%. Offered by: Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10 mg, 100 mg, 50 mg, 5 mg, 25 mg.
O-hexanoylcarnitine is an O-acylcarnitine compound having hexanoyl as the acyl substituent. It has a role as a human metabolite. It is an O-acylcarnitine and a hexanoate ester.
Source: ChEBI
| Molecular formula | C13H25NO4 |
|---|---|
| Molecular weight | 259.34 g/mol |
| IUPAC name | 3-hexanoyloxy-4-(trimethylazaniumyl)butanoate |
| InChIKey | VVPRQWTYSNDTEA-UHFFFAOYSA-N |
| SMILES | CCCCCC(=O)OC(CC(=O)[O-])C[N+](C)(C)C |
Computed by PubChem (NCBI)