Products 2692652-49-4
CAS 2692652-49-4 is the registry number for FabH-IN-1. Offered by: MedChemExpress. Available pack sizes: Get quote.
N-(4-methoxyphenyl)-4-(2-methyl-1,3-thiazol-4-yl)aniline (CAS 2692652-49-4) is a chemical compound with the molecular formula C17H16N2OS and a molecular weight of 296.4 g/mol. IUPAC name: N-(4-methoxyphenyl)-4-(2-methyl-1,3-thiazol-4-yl)aniline. InChIKey: IMYGXYNLMIFDEG-UHFFFAOYSA-N.
| Molecular formula | C17H16N2OS |
|---|---|
| Molecular weight | 296.4 g/mol |
| IUPAC name | N-(4-methoxyphenyl)-4-(2-methyl-1,3-thiazol-4-yl)aniline |
| InChIKey | IMYGXYNLMIFDEG-UHFFFAOYSA-N |
| SMILES | CC1=NC(=CS1)C2=CC=C(C=C2)NC3=CC=C(C=C3)OC |
Computed by PubChem (NCBI)
Synonyms:
FabH-IN-1, orb1689384