CAS 26928-74-5 is the registry number for Promazine Sulfone N-Oxide (Promazine N,S,S-Trioxide). Offered by: Mikromol. Available pack sizes: 100mg.
3-(5,5-dioxophenothiazin-10-yl)-N,N-dimethylpropan-1-amine oxide (CAS 26928-74-5) is a chemical compound with the molecular formula C17H20N2O3S and a molecular weight of 332.4 g/mol. IUPAC name: 3-(5,5-dioxophenothiazin-10-yl)-N,N-dimethylpropan-1-amine oxide. InChIKey: GFHGUVKVMPFKGH-UHFFFAOYSA-N.
| Molecular formula | C17H20N2O3S |
|---|---|
| Molecular weight | 332.4 g/mol |
| IUPAC name | 3-(5,5-dioxophenothiazin-10-yl)-N,N-dimethylpropan-1-amine oxide |
| InChIKey | GFHGUVKVMPFKGH-UHFFFAOYSA-N |
| SMILES | C[N+](C)(CCCN1C2=CC=CC=C2S(=O)(=O)C3=CC=CC=C31)[O-] |
Computed by PubChem (NCBI)