Products 26928-74-5

CAS 26928-74-5 is the registry number for Promazine Sulfone N-Oxide (Promazine N,S,S-Trioxide). Offered by: Mikromol. Available pack sizes: 100mg.

Structural formula: {0} (CAS {1})

3-(5,5-dioxophenothiazin-10-yl)-N,N-dimethylpropan-1-amine oxide (CAS 26928-74-5) is a chemical compound with the molecular formula C17H20N2O3S and a molecular weight of 332.4 g/mol. IUPAC name: 3-(5,5-dioxophenothiazin-10-yl)-N,N-dimethylpropan-1-amine oxide. InChIKey: GFHGUVKVMPFKGH-UHFFFAOYSA-N.

Identity
Molecular formulaC17H20N2O3S
Molecular weight332.4 g/mol
IUPAC name3-(5,5-dioxophenothiazin-10-yl)-N,N-dimethylpropan-1-amine oxide
InChIKeyGFHGUVKVMPFKGH-UHFFFAOYSA-N
SMILESC[N+](C)(CCCN1C2=CC=CC=C2S(=O)(=O)C3=CC=CC=C31)[O-]

Computed by PubChem (NCBI)