CAS 329082-05-5 is the registry number for Ethyl 2-amino-5-([(2,4-dimethylphenyl)amino]carbonyl)-4-methylthiophene-3-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.
Ethyl 2-amino-5-[(2,4-dimethylphenyl)carbamoyl]-4-methylthiophene-3-carboxylate (CAS 329082-05-5) is a chemical compound with the molecular formula C17H20N2O3S and a molecular weight of 332.4 g/mol. IUPAC name: ethyl 2-amino-5-[(2,4-dimethylphenyl)carbamoyl]-4-methylthiophene-3-carboxylate. InChIKey: RGIGVZONEAHWJZ-UHFFFAOYSA-N.
| Molecular formula | C17H20N2O3S |
|---|---|
| Molecular weight | 332.4 g/mol |
| IUPAC name | ethyl 2-amino-5-[(2,4-dimethylphenyl)carbamoyl]-4-methylthiophene-3-carboxylate |
| InChIKey | RGIGVZONEAHWJZ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(SC(=C1C)C(=O)NC2=C(C=C(C=C2)C)C)N |
Computed by PubChem (NCBI)