CAS 26932-45-6 appears in our catalog under these names: D-Selenocystine, 95%, D-Selenocystine, (H-D-Sec-OH)2. Offered by: Combi-blocks, TRC, Iris Biotech, Chemat, Biosynth. Available pack sizes: 100mg, 250mg, 10mg, 1mg, 5mg, 50mg, 500mg, 1g.
(2S)-2-amino-3-[[(2S)-2-amino-2-carboxyethyl]diselanyl]propanoic acid (CAS 26932-45-6) is a chemical compound with the molecular formula C6H12N2O4Se2 and a molecular weight of 334.11 g/mol. IUPAC name: (2S)-2-amino-3-[[(2S)-2-amino-2-carboxyethyl]diselanyl]propanoic acid. InChIKey: JULROCUWKLNBSN-QWWZWVQMSA-N.
| Molecular formula | C6H12N2O4Se2 |
|---|---|
| Molecular weight | 334.11 g/mol |
| IUPAC name | (2S)-2-amino-3-[[(2S)-2-amino-2-carboxyethyl]diselanyl]propanoic acid |
| InChIKey | JULROCUWKLNBSN-QWWZWVQMSA-N |
| SMILES | C([C@H](C(=O)O)N)[Se][Se]C[C@H](C(=O)O)N |
Computed by PubChem (NCBI)