CAS 29621-88-3 appears in our catalog under these names: 3,3'-Diselenobis-L-alanine, L-Selenocystine, >95% (HPLC), L-Selenocystine/ 99.36% (existing batch purity), L–Selenocystine, (H-L-Sec-OH)2. Offered by: TRC, TargetMol, GLPBio, Iris Biotech, Chemat. Available pack sizes: 500mg, 100mg, 1g, 50mg, 200mg, 250mg, 5g, 2g.
(2R)-2-amino-3-[[(2R)-2-amino-2-carboxyethyl]diselanyl]propanoic acid (CAS 29621-88-3) is a chemical compound with the molecular formula C6H12N2O4Se2 and a molecular weight of 334.11 g/mol. IUPAC name: (2R)-2-amino-3-[[(2R)-2-amino-2-carboxyethyl]diselanyl]propanoic acid. InChIKey: JULROCUWKLNBSN-IMJSIDKUSA-N.
| Molecular formula | C6H12N2O4Se2 |
|---|---|
| Molecular weight | 334.11 g/mol |
| IUPAC name | (2R)-2-amino-3-[[(2R)-2-amino-2-carboxyethyl]diselanyl]propanoic acid |
| InChIKey | JULROCUWKLNBSN-IMJSIDKUSA-N |
| SMILES | C([C@@H](C(=O)O)N)[Se][Se]C[C@@H](C(=O)O)N |
Computed by PubChem (NCBI)