Products 2694046-04-1
CAS 2694046-04-1 is the registry number for Schisandrathera D. Offered by: MedChemExpress. Available pack sizes: 10 mg, 5 mg, 1 mg.
5-[(2S,3R)-2,3-dimethyl-4-(3,4,5-trimethoxyphenyl)butyl]-2,3-dimethoxyphenol (CAS 2694046-04-1) is a chemical compound with the molecular formula C23H32O6 and a molecular weight of 404.5 g/mol. IUPAC name: 5-[(2S,3R)-2,3-dimethyl-4-(3,4,5-trimethoxyphenyl)butyl]-2,3-dimethoxyphenol. InChIKey: KLMINEPDYIKLAR-LSDHHAIUSA-N.
| Molecular formula | C23H32O6 |
|---|---|
| Molecular weight | 404.5 g/mol |
| IUPAC name | 5-[(2S,3R)-2,3-dimethyl-4-(3,4,5-trimethoxyphenyl)butyl]-2,3-dimethoxyphenol |
| InChIKey | KLMINEPDYIKLAR-LSDHHAIUSA-N |
| SMILES | C[C@@H](CC1=CC(=C(C(=C1)OC)OC)O)[C@H](C)CC2=CC(=C(C(=C2)OC)OC)OC |
Computed by PubChem (NCBI)