CAS 269410-14-2 is the registry number for 2,4-Dimethoxy-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2,4-dimethoxy-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidine (CAS 269410-14-2) is a chemical compound with the molecular formula C12H19BN2O4 and a molecular weight of 266.10 g/mol. IUPAC name: 2,4-dimethoxy-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidine. InChIKey: IIDHDKYLBVMDBH-UHFFFAOYSA-N.
| Molecular formula | C12H19BN2O4 |
|---|---|
| Molecular weight | 266.10 g/mol |
| IUPAC name | 2,4-dimethoxy-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidine |
| InChIKey | IIDHDKYLBVMDBH-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=NC(=N2)OC)OC |
Computed by PubChem (NCBI)