CAS 1217500-85-0 appears in our catalog under these names: 5-Amino-2-(BOC-amino)methyl)phenylboronic acid, 96%, (5-Amino-2-(((tert-butoxycarbonyl)amino)methyl)phenyl)boronic acid, 96%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 100mg.
[5-amino-2-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]phenyl]boronic acid (CAS 1217500-85-0) is a chemical compound with the molecular formula C12H19BN2O4 and a molecular weight of 266.10 g/mol. IUPAC name: [5-amino-2-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]phenyl]boronic acid. InChIKey: HHFWXUSZRNSYRM-UHFFFAOYSA-N.
| Molecular formula | C12H19BN2O4 |
|---|---|
| Molecular weight | 266.10 g/mol |
| IUPAC name | [5-amino-2-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]phenyl]boronic acid |
| InChIKey | HHFWXUSZRNSYRM-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC(=C1)N)CNC(=O)OC(C)(C)C)(O)O |
Computed by PubChem (NCBI)