CAS 1855861-18-5 appears in our catalog under these names: 3,6-dimethoxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridazine, 95%, 95%, 3,6-Dimethoxylpyridazine-4-boronic acid pinacol ester, 95%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
3,6-dimethoxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridazine (CAS 1855861-18-5) is a chemical compound with the molecular formula C12H19BN2O4 and a molecular weight of 266.10 g/mol. IUPAC name: 3,6-dimethoxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridazine. InChIKey: WWPCWCMINWEOOM-UHFFFAOYSA-N.
| Molecular formula | C12H19BN2O4 |
|---|---|
| Molecular weight | 266.10 g/mol |
| IUPAC name | 3,6-dimethoxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridazine |
| InChIKey | WWPCWCMINWEOOM-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=NN=C2OC)OC |
Computed by PubChem (NCBI)