Products 2696257-57-3
CAS 2696257-57-3 is the registry number for rel-Methyl (4aS,7aS)-6-benzylhexahydropyrano[2,3-c]pyrrole-7a(2H)-carboxylate, 97%. Offered by: Ambeed, Chemat, BLDpharm. Available pack sizes: 100mg, 250mg, 1g.
Methyl (4aS,7aS)-6-benzyl-2,3,4,4a,5,7-hexahydropyrano[2,3-c]pyrrole-7a-carboxylate (CAS 2696257-57-3) is a chemical compound with the molecular formula C16H21NO3 and a molecular weight of 275.34 g/mol. IUPAC name: methyl (4aS,7aS)-6-benzyl-2,3,4,4a,5,7-hexahydropyrano[2,3-c]pyrrole-7a-carboxylate. InChIKey: NODNUZREMBJREV-GOEBONIOSA-N.
| Molecular formula | C16H21NO3 |
|---|---|
| Molecular weight | 275.34 g/mol |
| IUPAC name | methyl (4aS,7aS)-6-benzyl-2,3,4,4a,5,7-hexahydropyrano[2,3-c]pyrrole-7a-carboxylate |
| InChIKey | NODNUZREMBJREV-GOEBONIOSA-N |
| SMILES | COC(=O)[C@@]12CN(C[C@@H]1CCCO2)CC3=CC=CC=C3 |
Computed by PubChem (NCBI)