Products 2697138-33-1
CAS 2697138-33-1 is the registry number for 2-(3-Chloro-4-methylphenyl)-1H-indene-1,3(2H)-dione, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(3-chloro-4-methylphenyl)indene-1,3-dione (CAS 2697138-33-1) is a chemical compound with the molecular formula C16H11ClO2 and a molecular weight of 270.71 g/mol. IUPAC name: 2-(3-chloro-4-methylphenyl)indene-1,3-dione. InChIKey: HJOJHYQFRFZAGK-UHFFFAOYSA-N.
| Molecular formula | C16H11ClO2 |
|---|---|
| Molecular weight | 270.71 g/mol |
| IUPAC name | 2-(3-chloro-4-methylphenyl)indene-1,3-dione |
| InChIKey | HJOJHYQFRFZAGK-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)C2C(=O)C3=CC=CC=C3C2=O)Cl |
Computed by PubChem (NCBI)