CAS 60402-30-4 appears in our catalog under these names: 2-(4-Chlorophenyl)-6-methyl-4H-1-benzopyran-4-one, 97%, 4'-Chloro-6-methylflavone, 96%, 4'-Chloro-6-methylflavone, 97%, 97%. Offered by: Fluorochem, Combi-blocks, Chemat. Available pack sizes: 250mg, 1g, 5g, 100mg.
2-(4-chlorophenyl)-6-methylchromen-4-one (CAS 60402-30-4) is a chemical compound with the molecular formula C16H11ClO2 and a molecular weight of 270.71 g/mol. IUPAC name: 2-(4-chlorophenyl)-6-methylchromen-4-one. InChIKey: ZMRCCOUBQBXXHF-UHFFFAOYSA-N.
| Molecular formula | C16H11ClO2 |
|---|---|
| Molecular weight | 270.71 g/mol |
| IUPAC name | 2-(4-chlorophenyl)-6-methylchromen-4-one |
| InChIKey | ZMRCCOUBQBXXHF-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1)OC(=CC2=O)C3=CC=C(C=C3)Cl |
Computed by PubChem (NCBI)