Products 2697155-68-1
CAS 2697155-68-1 is the registry number for 4-bromo-2-(3-methyl-1-bicyclo[1.1.1]pentanyl)thiazole, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.
4-bromo-2-(3-methyl-1-bicyclo[1.1.1]pentanyl)-1,3-thiazole (CAS 2697155-68-1) is a chemical compound with the molecular formula C9H10BrNS and a molecular weight of 244.15 g/mol. IUPAC name: 4-bromo-2-(3-methyl-1-bicyclo[1.1.1]pentanyl)-1,3-thiazole. InChIKey: CEXQDPSJLUVSDR-UHFFFAOYSA-N.
| Molecular formula | C9H10BrNS |
|---|---|
| Molecular weight | 244.15 g/mol |
| IUPAC name | 4-bromo-2-(3-methyl-1-bicyclo[1.1.1]pentanyl)-1,3-thiazole |
| InChIKey | CEXQDPSJLUVSDR-UHFFFAOYSA-N |
| SMILES | CC12CC(C1)(C2)C3=NC(=CS3)Br |
Computed by PubChem (NCBI)