Products 88023-76-1
CAS 88023-76-1 appears in our catalog under these names: 4-Bromo-N,N-dimethylbenzothioamide, 95%, 95%, 4-Bromo-N,N-dimethylbenzothioamide, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
4-bromo-N,N-dimethylbenzenecarbothioamide (CAS 88023-76-1) is a chemical compound with the molecular formula C9H10BrNS and a molecular weight of 244.15 g/mol. IUPAC name: 4-bromo-N,N-dimethylbenzenecarbothioamide. InChIKey: PGCISTUCVIODLK-UHFFFAOYSA-N.
| Molecular formula | C9H10BrNS |
|---|---|
| Molecular weight | 244.15 g/mol |
| IUPAC name | 4-bromo-N,N-dimethylbenzenecarbothioamide |
| InChIKey | PGCISTUCVIODLK-UHFFFAOYSA-N |
| SMILES | CN(C)C(=S)C1=CC=C(C=C1)Br |
Computed by PubChem (NCBI)