Products 269736-40-5
CAS 269736-40-5 is the registry number for 2,4-Bis(trifluoromethyl)phenylisothiocyanate, 99%. Offered by: Fluorochem. Available pack sizes: 1g.
1-isothiocyanato-2,4-bis(trifluoromethyl)benzene (CAS 269736-40-5) is a chemical compound with the molecular formula C9H3F6NS and a molecular weight of 271.18 g/mol. IUPAC name: 1-isothiocyanato-2,4-bis(trifluoromethyl)benzene. InChIKey: XLGDIBPVRZAYLD-UHFFFAOYSA-N.
| Molecular formula | C9H3F6NS |
|---|---|
| Molecular weight | 271.18 g/mol |
| IUPAC name | 1-isothiocyanato-2,4-bis(trifluoromethyl)benzene |
| InChIKey | XLGDIBPVRZAYLD-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(F)(F)F)C(F)(F)F)N=C=S |
Computed by PubChem (NCBI)