CAS 512179-73-6 is the registry number for 2,5-Bis(trifluoromethyl)phenylisothiocyanate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
2-isothiocyanato-1,4-bis(trifluoromethyl)benzene (CAS 512179-73-6) is a chemical compound with the molecular formula C9H3F6NS and a molecular weight of 271.18 g/mol. IUPAC name: 2-isothiocyanato-1,4-bis(trifluoromethyl)benzene. InChIKey: LIDXGQJPAJBFKJ-UHFFFAOYSA-N.
| Molecular formula | C9H3F6NS |
|---|---|
| Molecular weight | 271.18 g/mol |
| IUPAC name | 2-isothiocyanato-1,4-bis(trifluoromethyl)benzene |
| InChIKey | LIDXGQJPAJBFKJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(F)(F)F)N=C=S)C(F)(F)F |
Computed by PubChem (NCBI)