CAS 26974-15-2 is the registry number for Celecoxib Impurity 8. Offered by: Hubei YoungXin. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.
3-(4-methylphenyl)-5-(trifluoromethyl)-1H-pyrazole (CAS 26974-15-2) is a chemical compound with the molecular formula C11H9F3N2 and a molecular weight of 226.20 g/mol. IUPAC name: 3-(4-methylphenyl)-5-(trifluoromethyl)-1H-pyrazole. InChIKey: NQEFIPVOJGJVRG-UHFFFAOYSA-N.
| Molecular formula | C11H9F3N2 |
|---|---|
| Molecular weight | 226.20 g/mol |
| IUPAC name | 3-(4-methylphenyl)-5-(trifluoromethyl)-1H-pyrazole |
| InChIKey | NQEFIPVOJGJVRG-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C2=NNC(=C2)C(F)(F)F |
Computed by PubChem (NCBI)