Products 26974-15-2

CAS 26974-15-2 is the registry number for Celecoxib Impurity 8. Offered by: Hubei YoungXin. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.

Structural formula: {0} (CAS {1})

3-(4-methylphenyl)-5-(trifluoromethyl)-1H-pyrazole (CAS 26974-15-2) is a chemical compound with the molecular formula C11H9F3N2 and a molecular weight of 226.20 g/mol. IUPAC name: 3-(4-methylphenyl)-5-(trifluoromethyl)-1H-pyrazole. InChIKey: NQEFIPVOJGJVRG-UHFFFAOYSA-N.

Identity
Molecular formulaC11H9F3N2
Molecular weight226.20 g/mol
IUPAC name3-(4-methylphenyl)-5-(trifluoromethyl)-1H-pyrazole
InChIKeyNQEFIPVOJGJVRG-UHFFFAOYSA-N
SMILESCC1=CC=C(C=C1)C2=NNC(=C2)C(F)(F)F

Computed by PubChem (NCBI)