CAS 875740-46-8 is the registry number for 1-([2-(Trifluoromethyl)phenyl]methyl)-1h-pyrazole, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
1-[[2-(trifluoromethyl)phenyl]methyl]pyrazole (CAS 875740-46-8) is a chemical compound with the molecular formula C11H9F3N2 and a molecular weight of 226.20 g/mol. IUPAC name: 1-[[2-(trifluoromethyl)phenyl]methyl]pyrazole. InChIKey: CGNSXMZFNVPNSM-UHFFFAOYSA-N.
| Molecular formula | C11H9F3N2 |
|---|---|
| Molecular weight | 226.20 g/mol |
| IUPAC name | 1-[[2-(trifluoromethyl)phenyl]methyl]pyrazole |
| InChIKey | CGNSXMZFNVPNSM-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)CN2C=CC=N2)C(F)(F)F |
Computed by PubChem (NCBI)