CAS 2698-43-3 is the registry number for 2-[(2-Fluorophenyl)methylidene]propanedinitrile, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
2-[(2-fluorophenyl)methylidene]propanedinitrile (CAS 2698-43-3) is a chemical compound with the molecular formula C10H5FN2 and a molecular weight of 172.16 g/mol. IUPAC name: 2-[(2-fluorophenyl)methylidene]propanedinitrile. InChIKey: XLEWRBXVBOUONK-UHFFFAOYSA-N.
| Molecular formula | C10H5FN2 |
|---|---|
| Molecular weight | 172.16 g/mol |
| IUPAC name | 2-[(2-fluorophenyl)methylidene]propanedinitrile |
| InChIKey | XLEWRBXVBOUONK-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C=C(C#N)C#N)F |
Computed by PubChem (NCBI)