CAS 2826-22-4 appears in our catalog under these names: 2-(4-Fluorobenzylidene)malononitrile 97%, 2-(4-Fluorobenzylidene)malononitrile, 97%, 2-(4-Fluorobenzylidene)malononitrile, 97%, 97%. Offered by: Ambeed, Fluorochem, Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100mg.
2-[(4-fluorophenyl)methylidene]propanedinitrile (CAS 2826-22-4) is a chemical compound with the molecular formula C10H5FN2 and a molecular weight of 172.16 g/mol. IUPAC name: 2-[(4-fluorophenyl)methylidene]propanedinitrile. InChIKey: XPUISCUAQHJPRK-UHFFFAOYSA-N.
| Molecular formula | C10H5FN2 |
|---|---|
| Molecular weight | 172.16 g/mol |
| IUPAC name | 2-[(4-fluorophenyl)methylidene]propanedinitrile |
| InChIKey | XPUISCUAQHJPRK-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C=C(C#N)C#N)F |
Computed by PubChem (NCBI)