CAS 27023-37-6 is the registry number for Chlorotrityl chloride. Offered by: Biosynth. Available pack sizes: 0,1g, 0,01g, 0,025g, 0,05g, 0,25g.
1-chloro-4-[chloro(diphenyl)methyl]benzene (CAS 27023-37-6) is a chemical compound with the molecular formula C19H14Cl2 and a molecular weight of 313.2 g/mol. IUPAC name: 1-chloro-4-[chloro(diphenyl)methyl]benzene. InChIKey: LMSWYOHFMJDYAF-UHFFFAOYSA-N.
| Molecular formula | C19H14Cl2 |
|---|---|
| Molecular weight | 313.2 g/mol |
| IUPAC name | 1-chloro-4-[chloro(diphenyl)methyl]benzene |
| InChIKey | LMSWYOHFMJDYAF-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(C2=CC=CC=C2)(C3=CC=C(C=C3)Cl)Cl |
Computed by PubChem (NCBI)