Products 27023-37-6

CAS 27023-37-6 is the registry number for Chlorotrityl chloride. Offered by: Biosynth. Available pack sizes: 0,1g, 0,01g, 0,025g, 0,05g, 0,25g.

Structural formula: {0} (CAS {1})

1-chloro-4-[chloro(diphenyl)methyl]benzene (CAS 27023-37-6) is a chemical compound with the molecular formula C19H14Cl2 and a molecular weight of 313.2 g/mol. IUPAC name: 1-chloro-4-[chloro(diphenyl)methyl]benzene. InChIKey: LMSWYOHFMJDYAF-UHFFFAOYSA-N.

Identity
Molecular formulaC19H14Cl2
Molecular weight313.2 g/mol
IUPAC name1-chloro-4-[chloro(diphenyl)methyl]benzene
InChIKeyLMSWYOHFMJDYAF-UHFFFAOYSA-N
SMILESC1=CC=C(C=C1)C(C2=CC=CC=C2)(C3=CC=C(C=C3)Cl)Cl

Computed by PubChem (NCBI)