CAS 42074-68-0 appears in our catalog under these names: 2-Chlorotrityl chloride, 95%, Clotrimazole EP Impurity C, 2-Chlorotrityl Chloride (90%), >95% (HPLC), 2-Chlorotrityl Chloride, 1-Chloro-2-(chlorodiphenylmethyl)benzene. Offered by: Combi-blocks, Chemat Brand, TRC, Mikromol, GLPBio. Available pack sizes: 100g, 1kg, 500g, 25g, 5g, on request, 1g, 10g.
1-chloro-2-[chloro(diphenyl)methyl]benzene (CAS 42074-68-0) is a chemical compound with the molecular formula C19H14Cl2 and a molecular weight of 313.2 g/mol. IUPAC name: 1-chloro-2-[chloro(diphenyl)methyl]benzene. InChIKey: JFLSOKIMYBSASW-UHFFFAOYSA-N.
| Molecular formula | C19H14Cl2 |
|---|---|
| Molecular weight | 313.2 g/mol |
| IUPAC name | 1-chloro-2-[chloro(diphenyl)methyl]benzene |
| InChIKey | JFLSOKIMYBSASW-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(C2=CC=CC=C2)(C3=CC=CC=C3Cl)Cl |
Computed by PubChem (NCBI)