CAS 926266-56-0 is the registry number for 2-(2-Amino-5-fluorophenoxy)-N-tert-butylacetamide, 95%. Offered by: AmBeed. Available pack sizes: 5g.
2-(2-amino-5-fluorophenoxy)-N-tert-butylacetamide (CAS 926266-56-0) is a chemical compound with the molecular formula C12H17FN2O2 and a molecular weight of 240.27 g/mol. IUPAC name: 2-(2-amino-5-fluorophenoxy)-N-tert-butylacetamide. InChIKey: ZGMZUXQGWOVQBH-UHFFFAOYSA-N.
| Molecular formula | C12H17FN2O2 |
|---|---|
| Molecular weight | 240.27 g/mol |
| IUPAC name | 2-(2-amino-5-fluorophenoxy)-N-tert-butylacetamide |
| InChIKey | ZGMZUXQGWOVQBH-UHFFFAOYSA-N |
| SMILES | CC(C)(C)NC(=O)COC1=C(C=CC(=C1)F)N |
Computed by PubChem (NCBI)