Products 2703627-79-4
CAS 2703627-79-4 is the registry number for 4-tert-Butyl-2,6-dimethylbenzylamine hydrochloride. Offered by: Biosynth. Available pack sizes: 2000mg, 1000mg, 5000mg.
(4-tert-butyl-2,6-dimethylphenyl)methanamine;hydrochloride (CAS 2703627-79-4) is a chemical compound with the molecular formula C13H22ClN and a molecular weight of 227.77 g/mol. IUPAC name: (4-tert-butyl-2,6-dimethylphenyl)methanamine;hydrochloride. InChIKey: BQFXJRBQNYRGHG-UHFFFAOYSA-N.
| Molecular formula | C13H22ClN |
|---|---|
| Molecular weight | 227.77 g/mol |
| IUPAC name | (4-tert-butyl-2,6-dimethylphenyl)methanamine;hydrochloride |
| InChIKey | BQFXJRBQNYRGHG-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1CN)C)C(C)(C)C.Cl |
Computed by PubChem (NCBI)