Products 2703697-06-5
CAS 2703697-06-5 is the registry number for (S)-2-Amino-2-(6-(trifluoromethyl)pyridin-3-yl)ethan-1-ol dihydrochloride, 98%. Offered by: Fluorochem. Available pack sizes: 25mg, 50mg.
(2S)-2-amino-2-[6-(trifluoromethyl)-3-pyridinyl]ethanol;dihydrochloride (CAS 2703697-06-5) is a chemical compound with the molecular formula C8H11Cl2F3N2O and a molecular weight of 279.08 g/mol. IUPAC name: (2S)-2-amino-2-[6-(trifluoromethyl)-3-pyridinyl]ethanol;dihydrochloride. InChIKey: OGUVDEIXTRYRGX-QYCVXMPOSA-N.
| Molecular formula | C8H11Cl2F3N2O |
|---|---|
| Molecular weight | 279.08 g/mol |
| IUPAC name | (2S)-2-amino-2-[6-(trifluoromethyl)-3-pyridinyl]ethanol;dihydrochloride |
| InChIKey | OGUVDEIXTRYRGX-QYCVXMPOSA-N |
| SMILES | C1=CC(=NC=C1[C@@H](CO)N)C(F)(F)F.Cl.Cl |
Computed by PubChem (NCBI)