CAS 2703748-83-6 is the registry number for tert-Butyl (S)-3-(piperazin-1-yl)pyrrolidine-1-carboxylate hydrochloride, 95%. Offered by: AmBeed. Available pack sizes: 5g.
Tert-butyl (3S)-3-piperazin-1-ylpyrrolidine-1-carboxylate;hydrochloride (CAS 2703748-83-6) is a chemical compound with the molecular formula C13H26ClN3O2 and a molecular weight of 291.82 g/mol. IUPAC name: tert-butyl (3S)-3-piperazin-1-ylpyrrolidine-1-carboxylate;hydrochloride. InChIKey: CPZJCUJZNASBJI-MERQFXBCSA-N.
| Molecular formula | C13H26ClN3O2 |
|---|---|
| Molecular weight | 291.82 g/mol |
| IUPAC name | tert-butyl (3S)-3-piperazin-1-ylpyrrolidine-1-carboxylate;hydrochloride |
| InChIKey | CPZJCUJZNASBJI-MERQFXBCSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC[C@@H](C1)N2CCNCC2.Cl |
Computed by PubChem (NCBI)