Products 2940938-63-4

CAS 2940938-63-4 is the registry number for tert-Butyl (1-(azetidin-3-yl)piperidin-4-yl)carbamate hydrochloride, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g.

Structural formula: {0} (CAS {1})

Tert-butyl N-[1-(azetidin-3-yl)piperidin-4-yl]carbamate;hydrochloride (CAS 2940938-63-4) is a chemical compound with the molecular formula C13H26ClN3O2 and a molecular weight of 291.82 g/mol. IUPAC name: tert-butyl N-[1-(azetidin-3-yl)piperidin-4-yl]carbamate;hydrochloride. InChIKey: COEXQMFHHCPMIF-UHFFFAOYSA-N.

Identity
Molecular formulaC13H26ClN3O2
Molecular weight291.82 g/mol
IUPAC nametert-butyl N-[1-(azetidin-3-yl)piperidin-4-yl]carbamate;hydrochloride
InChIKeyCOEXQMFHHCPMIF-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)NC1CCN(CC1)C2CNC2.Cl

Computed by PubChem (NCBI)