Products 2703812-37-5
CAS 2703812-37-5 appears in our catalog under these names: AB–CHMINACA metabolite M4–d4 (CRM), AB–CHMINACA metabolite M4–d4, AB-CHMINACA metabolite M4-d4. Offered by: GLPBio, MedChemExpress. Available pack sizes: 100μg, 1mg, 500μg, 500 μg, 1 mg.
1-(cyclohexylmethyl)-4,5,6,7-tetradeuterioindazole-3-carboxylic acid (CAS 2703812-37-5) is a chemical compound with the molecular formula C15H18N2O2 and a molecular weight of 262.34 g/mol. IUPAC name: 1-(cyclohexylmethyl)-4,5,6,7-tetradeuterioindazole-3-carboxylic acid. InChIKey: DVXHKIOGZJHOPD-DOGSKSIHSA-N.
| Molecular formula | C15H18N2O2 |
|---|---|
| Molecular weight | 262.34 g/mol |
| IUPAC name | 1-(cyclohexylmethyl)-4,5,6,7-tetradeuterioindazole-3-carboxylic acid |
| InChIKey | DVXHKIOGZJHOPD-DOGSKSIHSA-N |
| SMILES | [2H]C1=C(C(=C2C(=C1[2H])C(=NN2CC3CCCCC3)C(=O)O)[2H])[2H] |
Computed by PubChem (NCBI)